C34H48BNO4 — CID 159707939
tert-butyl 4-[2,3-dimethyl-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate (PubChem CID 159707939) has the molecular formula C34H48BNO4 and a molecular weight of 545.57 g/mol. Its IUPAC name is tert-butyl 4-[2,3-dimethyl-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,3-dimethyl-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159707939 |
| Molecular Formula | C34H48BNO4 |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.37 |
| IUPAC Name | tert-butyl 4-[2,3-dimethyl-4-[[7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate |
| SMILES | Cc1c(CC2CCc3cccc(B4OC(C)(C)C(C)(C)O4)c32)ccc(C2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C34H48BNO4/c1-22-23(2)28(24-17-19-36(20-18-24)31(37)38-32(3,4)5)16-15-26(22)21-27-14-13-25-11-10-12-29(30(25)27)35-39-33(6,7)34(8,9)40-35/h10-12,15-16,24,27H,13-14,17-21H2,1-9H3 |
| InChIKey | QEVMUZRTGDKEAV-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|