C18H24N2O3 — CID 166132108
tert-butyl 4-(2-oxo-1,3-dihydroindol-4-yl)piperidine-1-carboxylate (PubChem CID 166132108) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is tert-butyl 4-(2-oxo-1,3-dihydroindol-4-yl)piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-oxo-1,3-dihydroindol-4-yl)piperidine-1-carboxylate |
|---|---|
| PubChem CID | 166132108 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | tert-butyl 4-(2-oxo-1,3-dihydroindol-4-yl)piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2cccc3c2CC(=O)N3)CC1 |
| InChI | InChI=1S/C18H24N2O3/c1-18(2,3)23-17(22)20-9-7-12(8-10-20)13-5-4-6-15-14(13)11-16(21)19-15/h4-6,12H,7-11H2,1-3H3,(H,19,21) |
| InChIKey | WOQKWNOQTIFBRU-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |