C26H39BN2O4 — CID 147015714
tert-butyl 4-[3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-5-yl]piperidine-1-carboxylate (PubChem CID 147015714) has the molecular formula C26H39BN2O4 and a molecular weight of 454.42 g/mol. Its IUPAC name is tert-butyl 4-[3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 147015714 |
| Molecular Formula | C26H39BN2O4 |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.30 |
| IUPAC Name | tert-butyl 4-[3-ethyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indol-5-yl]piperidine-1-carboxylate |
| SMILES | CCc1c(B2OC(C)(C)C(C)(C)O2)[nH]c2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C26H39BN2O4/c1-9-19-20-16-18(17-12-14-29(15-13-17)23(30)31-24(2,3)4)10-11-21(20)28-22(19)27-32-25(5,6)26(7,8)33-27/h10-11,16-17,28H,9,12-15H2,1-8H3 |
| InChIKey | AUSQARPYLWMTCD-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 63.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|