C32H40BrN4O4+ — CID 142593920
tert-butyl 3-bromo-4-[3-ethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indol-2-yl]-1H-pyrrolo[2,3-b]pyridin-7-ium-7-carboxylate (PubChem CID 142593920) has the molecular formula C32H40BrN4O4+ and a molecular weight of 624.60 g/mol. Its IUPAC name is tert-butyl 3-bromo-4-[3-ethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indol-2-yl]-1H-pyrrolo[2,3-b]pyridin-7-ium-7-carboxylate.
| Compound Name | tert-butyl 3-bromo-4-[3-ethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indol-2-yl]-1H-pyrrolo[2,3-b]pyridin-7-ium-7-carboxylate |
|---|---|
| PubChem CID | 142593920 |
| Molecular Formula | C32H40BrN4O4+ |
| Molecular Weight | 624.60 g/mol |
| Exact Mass | 623.22 |
| IUPAC Name | tert-butyl 3-bromo-4-[3-ethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]-1H-indol-2-yl]-1H-pyrrolo[2,3-b]pyridin-7-ium-7-carboxylate |
| SMILES | CCc1c(-c2cc[n+](C(=O)OC(C)(C)C)c3[nH]cc(Br)c23)[nH]c2ccc(C3CCN(C(=O)OC(C)(C)C)CC3)cc12 |
| InChI | InChI=1S/C32H39BrN4O4/c1-8-21-23-17-20(19-11-14-36(15-12-19)29(38)40-31(2,3)4)9-10-25(23)35-27(21)22-13-16-37(30(39)41-32(5,6)7)28-26(22)24(33)18-34-28/h9-10,13,16-19H,8,11-12,14-15H2,1-7H3,(H,34,35)/p+1 |
| InChIKey | HFRBNKVSZSPGMM-UHFFFAOYSA-O |
| XLogP | 7.83 |
| TPSA | 91.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.60 |
| LogP ≤ 5 | 7.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_het_A(9)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|