C27H34ClN3O2 — CID 134329777
tert-butyl 4-[2-(2-chloro-6-methyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate (PubChem CID 134329777) has the molecular formula C27H34ClN3O2 and a molecular weight of 468.04 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-chloro-6-methyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-chloro-6-methyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 134329777 |
| Molecular Formula | C27H34ClN3O2 |
| Molecular Weight | 468.04 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | tert-butyl 4-[2-(2-chloro-6-methyl-4-pyridinyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2[nH]c3ccc(C4CCN(C(=O)OC(C)(C)C)CC4)cc3c2C(C)C)cc(Cl)n1 |
| InChI | InChI=1S/C27H34ClN3O2/c1-16(2)24-21-14-19(18-9-11-31(12-10-18)26(32)33-27(4,5)6)7-8-22(21)30-25(24)20-13-17(3)29-23(28)15-20/h7-8,13-16,18,30H,9-12H2,1-6H3 |
| InChIKey | LDAABMXQJYLWPE-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.04 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|