C35H41N3O5 — CID 154637639
tert-butyl 4-[2-(3-methyl-4-nitro-5-phenylmethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate (PubChem CID 154637639) has the molecular formula C35H41N3O5 and a molecular weight of 583.73 g/mol. Its IUPAC name is tert-butyl 4-[2-(3-methyl-4-nitro-5-phenylmethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(3-methyl-4-nitro-5-phenylmethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 154637639 |
| Molecular Formula | C35H41N3O5 |
| Molecular Weight | 583.73 g/mol |
| Exact Mass | 583.30 |
| IUPAC Name | tert-butyl 4-[2-(3-methyl-4-nitro-5-phenylmethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidine-1-carboxylate |
| SMILES | Cc1cc(-c2[nH]c3ccc(C4CCN(C(=O)OC(C)(C)C)CC4)cc3c2C(C)C)cc(OCc2ccccc2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C35H41N3O5/c1-22(2)31-28-19-26(25-14-16-37(17-15-25)34(39)43-35(4,5)6)12-13-29(28)36-32(31)27-18-23(3)33(38(40)41)30(20-27)42-21-24-10-8-7-9-11-24/h7-13,18-20,22,25,36H,14-17,21H2,1-6H3 |
| InChIKey | DMVXUHDNWFPGTH-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 97.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.73 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|