C33H45N3O5 — CID 134241024
tert-butyl N-[4-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-4-oxobutyl]carbamate (PubChem CID 134241024) has the molecular formula C33H45N3O5 and a molecular weight of 563.74 g/mol. Its IUPAC name is tert-butyl N-[4-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-4-oxobutyl]carbamate.
| Compound Name | tert-butyl N-[4-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-4-oxobutyl]carbamate |
|---|---|
| PubChem CID | 134241024 |
| Molecular Formula | C33H45N3O5 |
| Molecular Weight | 563.74 g/mol |
| Exact Mass | 563.34 |
| IUPAC Name | tert-butyl N-[4-[4-[2-(3,4-dimethoxyphenyl)-3-propan-2-yl-1H-indol-5-yl]piperidin-1-yl]-4-oxobutyl]carbamate |
| SMILES | COc1ccc(-c2[nH]c3ccc(C4CCN(C(=O)CCCNC(=O)OC(C)(C)C)CC4)cc3c2C(C)C)cc1OC |
| InChI | InChI=1S/C33H45N3O5/c1-21(2)30-25-19-23(10-12-26(25)35-31(30)24-11-13-27(39-6)28(20-24)40-7)22-14-17-36(18-15-22)29(37)9-8-16-34-32(38)41-33(3,4)5/h10-13,19-22,35H,8-9,14-18H2,1-7H3,(H,34,38) |
| InChIKey | XYCIYWOMATVVHP-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 92.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.74 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|