C25H34BFN2O5 — CID 171112683
tert-butyl 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-oxo-1H-indol-5-yl]piperidine-1-carboxylate (PubChem CID 171112683) has the molecular formula C25H34BFN2O5 and a molecular weight of 472.37 g/mol. Its IUPAC name is tert-butyl 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-oxo-1H-indol-5-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-oxo-1H-indol-5-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 171112683 |
| Molecular Formula | C25H34BFN2O5 |
| Molecular Weight | 472.37 g/mol |
| Exact Mass | 472.25 |
| IUPAC Name | tert-butyl 4-[3-[fluoro-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methylidene]-2-oxo-1H-indol-5-yl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(c2ccc3c(c2)C(=C(F)B2OC(C)(C)C(C)(C)O2)C(=O)N3)CC1 |
| InChI | InChI=1S/C25H34BFN2O5/c1-23(2,3)32-22(31)29-12-10-15(11-13-29)16-8-9-18-17(14-16)19(21(30)28-18)20(27)26-33-24(4,5)25(6,7)34-26/h8-9,14-15H,10-13H2,1-7H3,(H,28,30) |
| InChIKey | AVZFBSNNMDVXAJ-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.37 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|