C29H36F3NO5S — CID 159707938
tert-butyl 4-[2,3-dimethyl-4-[[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate (PubChem CID 159707938) has the molecular formula C29H36F3NO5S and a molecular weight of 567.67 g/mol. Its IUPAC name is tert-butyl 4-[2,3-dimethyl-4-[[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2,3-dimethyl-4-[[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 159707938 |
| Molecular Formula | C29H36F3NO5S |
| Molecular Weight | 567.67 g/mol |
| Exact Mass | 567.23 |
| IUPAC Name | tert-butyl 4-[2,3-dimethyl-4-[[7-(trifluoromethylsulfonyloxy)-2,3-dihydro-1H-inden-1-yl]methyl]phenyl]piperidine-1-carboxylate |
| SMILES | Cc1c(CC2CCc3cccc(OS(=O)(=O)C(F)(F)F)c32)ccc(C2CCN(C(=O)OC(C)(C)C)CC2)c1C |
| InChI | InChI=1S/C29H36F3NO5S/c1-18-19(2)24(20-13-15-33(16-14-20)27(34)37-28(3,4)5)12-11-22(18)17-23-10-9-21-7-6-8-25(26(21)23)38-39(35,36)29(30,31)32/h6-8,11-12,20,23H,9-10,13-17H2,1-5H3 |
| InChIKey | OSJLWIKFHSDMAT-UHFFFAOYSA-N |
| XLogP | 6.92 |
| TPSA | 72.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.67 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|