C27H38F3NO6S — CID 130200045
tert-butyl 4-[2-ethyl-4-[[6-methyl-2-(trifluoromethylsulfonyloxy)cyclohexen-1-yl]methoxy]phenyl]piperidine-1-carboxylate (PubChem CID 130200045) has the molecular formula C27H38F3NO6S and a molecular weight of 561.66 g/mol. Its IUPAC name is tert-butyl 4-[2-ethyl-4-[[6-methyl-2-(trifluoromethylsulfonyloxy)cyclohexen-1-yl]methoxy]phenyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-ethyl-4-[[6-methyl-2-(trifluoromethylsulfonyloxy)cyclohexen-1-yl]methoxy]phenyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 130200045 |
| Molecular Formula | C27H38F3NO6S |
| Molecular Weight | 561.66 g/mol |
| Exact Mass | 561.24 |
| IUPAC Name | tert-butyl 4-[2-ethyl-4-[[6-methyl-2-(trifluoromethylsulfonyloxy)cyclohexen-1-yl]methoxy]phenyl]piperidine-1-carboxylate |
| SMILES | CCc1cc(OCC2=C(OS(=O)(=O)C(F)(F)F)CCCC2C)ccc1C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C27H38F3NO6S/c1-6-19-16-21(10-11-22(19)20-12-14-31(15-13-20)25(32)36-26(3,4)5)35-17-23-18(2)8-7-9-24(23)37-38(33,34)27(28,29)30/h10-11,16,18,20H,6-9,12-15,17H2,1-5H3 |
| InChIKey | PFISJTIABFCTNG-UHFFFAOYSA-N |
| XLogP | 6.68 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.66 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|