C17H18BNO — CID 54565321
(5S)-2-methyl-4,4-diphenyl-3-oxa-1-aza-2-borabicyclo[3.2.0]heptane (PubChem CID 54565321) has the molecular formula C17H18BNO and a molecular weight of 263.15 g/mol. Its IUPAC name is (5S)-2-methyl-4,4-diphenyl-3-oxa-1-aza-2-borabicyclo[3.2.0]heptane.
| Compound Name | (5S)-2-methyl-4,4-diphenyl-3-oxa-1-aza-2-borabicyclo[3.2.0]heptane |
|---|---|
| PubChem CID | 54565321 |
| Molecular Formula | C17H18BNO |
| Molecular Weight | 263.15 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | (5S)-2-methyl-4,4-diphenyl-3-oxa-1-aza-2-borabicyclo[3.2.0]heptane |
| SMILES | CB1OC(c2ccccc2)(c2ccccc2)[C@@H]2CCN12 |
| InChI | InChI=1S/C17H18BNO/c1-18-19-13-12-16(19)17(20-18,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,16H,12-13H2,1H3/t16-/m0/s1 |
| InChIKey | ZTKKJOLFNJTJDG-INIZCTEOSA-N |
| XLogP | 3.15 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.15 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|