C24H24BNO — CID 68925330
(3aR)-1-methyl-3,3,6-triphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 68925330) has the molecular formula C24H24BNO and a molecular weight of 353.27 g/mol. Its IUPAC name is (3aR)-1-methyl-3,3,6-triphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aR)-1-methyl-3,3,6-triphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 68925330 |
| Molecular Formula | C24H24BNO |
| Molecular Weight | 353.27 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | (3aR)-1-methyl-3,3,6-triphenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | CB1OC(c2ccccc2)(c2ccccc2)[C@H]2CCC(c3ccccc3)N12 |
| InChI | InChI=1S/C24H24BNO/c1-25-26-22(19-11-5-2-6-12-19)17-18-23(26)24(27-25,20-13-7-3-8-14-20)21-15-9-4-10-16-21/h2-16,22-23H,17-18H2,1H3/t22?,23-/m1/s1 |
| InChIKey | WNKCGHONSXWDAN-OZAIVSQSSA-N |
| XLogP | 5.28 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.27 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|