C23H19BF4NO+ — CID 155937309
(3aS)-1-(2,5-difluorophenyl)-5,5-difluoro-3,3-diphenyl-3a,4,6,7-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium (PubChem CID 155937309) has the molecular formula C23H19BF4NO+ and a molecular weight of 412.22 g/mol. Its IUPAC name is (3aS)-1-(2,5-difluorophenyl)-5,5-difluoro-3,3-diphenyl-3a,4,6,7-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium.
| Compound Name | (3aS)-1-(2,5-difluorophenyl)-5,5-difluoro-3,3-diphenyl-3a,4,6,7-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium |
|---|---|
| PubChem CID | 155937309 |
| Molecular Formula | C23H19BF4NO+ |
| Molecular Weight | 412.22 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | (3aS)-1-(2,5-difluorophenyl)-5,5-difluoro-3,3-diphenyl-3a,4,6,7-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborol-7-ium |
| SMILES | Fc1ccc(F)c(B2OC(c3ccccc3)(c3ccccc3)[C@@H]3CC(F)(F)C[NH+]23)c1 |
| InChI | InChI=1S/C23H18BF4NO/c25-18-11-12-20(26)19(13-18)24-29-15-22(27,28)14-21(29)23(30-24,16-7-3-1-4-8-16)17-9-5-2-6-10-17/h1-13,21H,14-15H2/p+1/t21-/m0/s1 |
| InChIKey | LVQWXLVHNQQBKN-NRFANRHFSA-O |
| XLogP | 2.93 |
| TPSA | 13.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.22 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|