C24H22AlBBr3F2NO — CID 134846544
(3aS)-5,5-difluoro-1-(2-methylphenyl)-3,3-diphenyl-4,6-dihydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborole;tribromoalumane (PubChem CID 134846544) has the molecular formula C24H22AlBBr3F2NO and a molecular weight of 655.95 g/mol. Its IUPAC name is (3aS)-5,5-difluoro-1-(2-methylphenyl)-3,3-diphenyl-4,6-dihydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborole;tribromoalumane.
| Compound Name | (3aS)-5,5-difluoro-1-(2-methylphenyl)-3,3-diphenyl-4,6-dihydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborole;tribromoalumane |
|---|---|
| PubChem CID | 134846544 |
| Molecular Formula | C24H22AlBBr3F2NO |
| Molecular Weight | 655.95 g/mol |
| Exact Mass | 652.91 |
| IUPAC Name | (3aS)-5,5-difluoro-1-(2-methylphenyl)-3,3-diphenyl-4,6-dihydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborole;tribromoalumane |
| SMILES | Br[Al](Br)Br.Cc1ccccc1B1OC(c2ccccc2)(c2ccccc2)[C@@H]2CC(F)(F)CN12 |
| InChI | InChI=1S/C24H22BF2NO.Al.3BrH/c1-18-10-8-9-15-21(18)25-28-17-23(26,27)16-22(28)24(29-25,19-11-4-2-5-12-19)20-13-6-3-7-14-20;;;;/h2-15,22H,16-17H2,1H3;;3*1H/q;+3;;;/p-3/t22-;;;;/m0..../s1 |
| InChIKey | DCQJPWHLYVDYSO-YSJNIUOTSA-K |
| XLogP | 6.53 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.95 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|