C28H16BClF15NO — CID 164673032
(3aR)-3,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-[4-chloro-2-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 164673032) has the molecular formula C28H16BClF15NO and a molecular weight of 713.68 g/mol. Its IUPAC name is (3aR)-3,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-[4-chloro-2-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aR)-3,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-[4-chloro-2-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 164673032 |
| Molecular Formula | C28H16BClF15NO |
| Molecular Weight | 713.68 g/mol |
| Exact Mass | 713.08 |
| IUPAC Name | (3aR)-3,3-bis[3,5-bis(trifluoromethyl)phenyl]-1-[4-chloro-2-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | FC(F)(F)c1cc(C(F)(F)F)cc(C2(c3cc(C(F)(F)F)cc(C(F)(F)F)c3)OB(c3ccc(Cl)cc3C(F)(F)F)N3CCC[C@@H]32)c1 |
| InChI | InChI=1S/C28H16BClF15NO/c30-19-3-4-21(20(12-19)28(43,44)45)29-46-5-1-2-22(46)23(47-29,13-6-15(24(31,32)33)10-16(7-13)25(34,35)36)14-8-17(26(37,38)39)11-18(9-14)27(40,41)42/h3-4,6-12,22H,1-2,5H2/t22-/m1/s1 |
| InChIKey | GVOHSUOJAYNPHM-JOCHJYFZSA-N |
| XLogP | 9.57 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 713.68 |
| LogP ≤ 5 | 9.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|