C27H27BF3NO — CID 162405671
(3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2,4,6-trifluorophenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 162405671) has the molecular formula C27H27BF3NO and a molecular weight of 449.33 g/mol. Its IUPAC name is (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2,4,6-trifluorophenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2,4,6-trifluorophenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 162405671 |
| Molecular Formula | C27H27BF3NO |
| Molecular Weight | 449.33 g/mol |
| Exact Mass | 449.21 |
| IUPAC Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2,4,6-trifluorophenyl)-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | Cc1cc(C)cc(C2(c3cc(C)cc(C)c3)OB(c3c(F)cc(F)cc3F)N3CCC[C@H]32)c1 |
| InChI | InChI=1S/C27H27BF3NO/c1-16-8-17(2)11-20(10-16)27(21-12-18(3)9-19(4)13-21)25-6-5-7-32(25)28(33-27)26-23(30)14-22(29)15-24(26)31/h8-15,25H,5-7H2,1-4H3/t25-/m0/s1 |
| InChIKey | OYIZYVLYRGWPEM-VWLOTQADSA-N |
| XLogP | 5.47 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.33 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|