C29H33BF3NO4S — CID 11753296
(3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;trifluoromethanesulfonate (PubChem CID 11753296) has the molecular formula C29H33BF3NO4S and a molecular weight of 559.46 g/mol. Its IUPAC name is (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;trifluoromethanesulfonate.
| Compound Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 11753296 |
| Molecular Formula | C29H33BF3NO4S |
| Molecular Weight | 559.46 g/mol |
| Exact Mass | 559.22 |
| IUPAC Name | (3aS)-3,3-bis(3,5-dimethylphenyl)-1-(2-methylphenyl)-4,5,6,7-tetrahydro-3aH-pyrrolo[1,2-c][1,3,2]oxazaborol-7-ium;trifluoromethanesulfonate |
| SMILES | Cc1cc(C)cc(C2(c3cc(C)cc(C)c3)OB(c3ccccc3C)[NH+]3CCC[C@H]32)c1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C28H32BNO.CHF3O3S/c1-19-13-20(2)16-24(15-19)28(25-17-21(3)14-22(4)18-25)27-11-8-12-30(27)29(31-28)26-10-7-6-9-23(26)5;2-1(3,4)8(5,6)7/h6-7,9-10,13-18,27H,8,11-12H2,1-5H3;(H,5,6,7)/t27-;/m0./s1 |
| InChIKey | RQUOVUNADJBKOW-YCBFMBTMSA-N |
| XLogP | 4.00 |
| TPSA | 70.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|