C24H21BF3NO — CID 14814045
(3aS)-3,3-diphenyl-1-[4-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 14814045) has the molecular formula C24H21BF3NO and a molecular weight of 407.24 g/mol. Its IUPAC name is (3aS)-3,3-diphenyl-1-[4-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | (3aS)-3,3-diphenyl-1-[4-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 14814045 |
| Molecular Formula | C24H21BF3NO |
| Molecular Weight | 407.24 g/mol |
| Exact Mass | 407.17 |
| IUPAC Name | (3aS)-3,3-diphenyl-1-[4-(trifluoromethyl)phenyl]-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | FC(F)(F)c1ccc(B2OC(c3ccccc3)(c3ccccc3)[C@@H]3CCCN23)cc1 |
| InChI | InChI=1S/C24H21BF3NO/c26-24(27,28)20-13-15-21(16-14-20)25-29-17-7-12-22(29)23(30-25,18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,13-16,22H,7,12,17H2/t22-/m0/s1 |
| InChIKey | YDCRPFGCHZLDNG-QFIPXVFZSA-N |
| XLogP | 4.84 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.24 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|