C30H29F3N2O2 — CID 174630006
1-[2-oxo-2-[3-[4-(trifluoromethyl)phenyl]azetidin-1-yl]ethyl]-3,3-diphenylpiperidine-2-carbaldehyde (PubChem CID 174630006) has the molecular formula C30H29F3N2O2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 1-[2-oxo-2-[3-[4-(trifluoromethyl)phenyl]azetidin-1-yl]ethyl]-3,3-diphenylpiperidine-2-carbaldehyde.
| Compound Name | 1-[2-oxo-2-[3-[4-(trifluoromethyl)phenyl]azetidin-1-yl]ethyl]-3,3-diphenylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174630006 |
| Molecular Formula | C30H29F3N2O2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.22 |
| IUPAC Name | 1-[2-oxo-2-[3-[4-(trifluoromethyl)phenyl]azetidin-1-yl]ethyl]-3,3-diphenylpiperidine-2-carbaldehyde |
| SMILES | O=CC1N(CC(=O)N2CC(c3ccc(C(F)(F)F)cc3)C2)CCCC1(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C30H29F3N2O2/c31-30(32,33)26-14-12-22(13-15-26)23-18-35(19-23)28(37)20-34-17-7-16-29(27(34)21-36,24-8-3-1-4-9-24)25-10-5-2-6-11-25/h1-6,8-15,21,23,27H,7,16-20H2 |
| InChIKey | JTGAJVLEFHLICN-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|