C23H23F3N2O2 — CID 174629960
1-[2-oxo-2-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]ethyl]-3-phenylpiperidine-2-carbaldehyde (PubChem CID 174629960) has the molecular formula C23H23F3N2O2 and a molecular weight of 416.44 g/mol. Its IUPAC name is 1-[2-oxo-2-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]ethyl]-3-phenylpiperidine-2-carbaldehyde.
| Compound Name | 1-[2-oxo-2-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]ethyl]-3-phenylpiperidine-2-carbaldehyde |
|---|---|
| PubChem CID | 174629960 |
| Molecular Formula | C23H23F3N2O2 |
| Molecular Weight | 416.44 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 1-[2-oxo-2-[5-(trifluoromethyl)-1,3-dihydroisoindol-2-yl]ethyl]-3-phenylpiperidine-2-carbaldehyde |
| SMILES | O=CC1C(c2ccccc2)CCCN1CC(=O)N1Cc2ccc(C(F)(F)F)cc2C1 |
| InChI | InChI=1S/C23H23F3N2O2/c24-23(25,26)19-9-8-17-12-28(13-18(17)11-19)22(30)14-27-10-4-7-20(21(27)15-29)16-5-2-1-3-6-16/h1-3,5-6,8-9,11,15,20-21H,4,7,10,12-14H2 |
| InChIKey | RXGGETRRQNCTPS-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.44 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|