C19H24BNO — CID 143706828
3-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole (PubChem CID 143706828) has the molecular formula C19H24BNO and a molecular weight of 293.22 g/mol. Its IUPAC name is 3-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole.
| Compound Name | 3-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
|---|---|
| PubChem CID | 143706828 |
| Molecular Formula | C19H24BNO |
| Molecular Weight | 293.22 g/mol |
| Exact Mass | 293.20 |
| IUPAC Name | 3-[(2Z,4Z)-hepta-2,4,6-trienyl]-1-methyl-3-phenyl-3a,4,5,6-tetrahydropyrrolo[1,2-c][1,3,2]oxazaborole |
| SMILES | C=C/C=C\C=C/CC1(c2ccccc2)OB(C)N2CCCC21 |
| InChI | InChI=1S/C19H24BNO/c1-3-4-5-6-10-15-19(17-12-8-7-9-13-17)18-14-11-16-21(18)20(2)22-19/h3-10,12-13,18H,1,11,14-16H2,2H3/b5-4-,10-6- |
| InChIKey | PVYFQCQOXNNWMM-ARSRRCBKSA-N |
| XLogP | 4.18 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.22 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|