C12H14O — CID 11367280
(2S,3S)-3-methyl-2-phenyl-2-prop-2-enyloxirane (PubChem CID 11367280) has the molecular formula C12H14O and a molecular weight of 174.24 g/mol. Its IUPAC name is (2S,3S)-3-methyl-2-phenyl-2-prop-2-enyloxirane.
| Compound Name | (2S,3S)-3-methyl-2-phenyl-2-prop-2-enyloxirane |
|---|---|
| PubChem CID | 11367280 |
| Molecular Formula | C12H14O |
| Molecular Weight | 174.24 g/mol |
| Exact Mass | 174.10 |
| IUPAC Name | (2S,3S)-3-methyl-2-phenyl-2-prop-2-enyloxirane |
| SMILES | C=CC[C@@]1(c2ccccc2)O[C@H]1C |
| InChI | InChI=1S/C12H14O/c1-3-9-12(10(2)13-12)11-7-5-4-6-8-11/h3-8,10H,1,9H2,2H3/t10-,12+/m0/s1 |
| InChIKey | ZTSTWOYWOYDZQC-CMPLNLGQSA-N |
| XLogP | 2.88 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.24 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|