C19H28O5 — CID 11186734
(2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)-2-phenyl-2-prop-2-enyloxane (PubChem CID 11186734) has the molecular formula C19H28O5 and a molecular weight of 336.43 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)-2-phenyl-2-prop-2-enyloxane.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)-2-phenyl-2-prop-2-enyloxane |
|---|---|
| PubChem CID | 11186734 |
| Molecular Formula | C19H28O5 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-trimethoxy-6-(methoxymethyl)-2-phenyl-2-prop-2-enyloxane |
| SMILES | C=CC[C@@]1(c2ccccc2)O[C@H](COC)[C@@H](OC)[C@H](OC)[C@H]1OC |
| InChI | InChI=1S/C19H28O5/c1-6-12-19(14-10-8-7-9-11-14)18(23-5)17(22-4)16(21-3)15(24-19)13-20-2/h6-11,15-18H,1,12-13H2,2-5H3/t15-,16-,17+,18-,19+/m1/s1 |
| InChIKey | ZUBPEBYJCZDGNF-FQBWVUSXSA-N |
| XLogP | 2.55 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|