C15H21N — CID 101369766
(2R,3R)-1-benzyl-2-ethyl-3-methyl-2-prop-2-enylaziridine (PubChem CID 101369766) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (2R,3R)-1-benzyl-2-ethyl-3-methyl-2-prop-2-enylaziridine.
| Compound Name | (2R,3R)-1-benzyl-2-ethyl-3-methyl-2-prop-2-enylaziridine |
|---|---|
| PubChem CID | 101369766 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2R,3R)-1-benzyl-2-ethyl-3-methyl-2-prop-2-enylaziridine |
| SMILES | C=CC[C@]1(CC)[C@@H](C)N1Cc1ccccc1 |
| InChI | InChI=1S/C15H21N/c1-4-11-15(5-2)13(3)16(15)12-14-9-7-6-8-10-14/h4,6-10,13H,1,5,11-12H2,2-3H3/t13-,15-,16?/m1/s1 |
| InChIKey | NTFOCMYAJRIPQF-CWSLVUQWSA-N |
| XLogP | 3.62 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|