C19H25NO3 — CID 10805298
(1R,2S,6S,8S)-3-benzyl-10,10-dimethyl-8-prop-2-enyl-4,9,11-trioxa-3-azatricyclo[6.3.0.02,6]undecane (PubChem CID 10805298) has the molecular formula C19H25NO3 and a molecular weight of 315.41 g/mol. Its IUPAC name is (1R,2S,6S,8S)-3-benzyl-10,10-dimethyl-8-prop-2-enyl-4,9,11-trioxa-3-azatricyclo[6.3.0.02,6]undecane.
| Compound Name | (1R,2S,6S,8S)-3-benzyl-10,10-dimethyl-8-prop-2-enyl-4,9,11-trioxa-3-azatricyclo[6.3.0.02,6]undecane |
|---|---|
| PubChem CID | 10805298 |
| Molecular Formula | C19H25NO3 |
| Molecular Weight | 315.41 g/mol |
| Exact Mass | 315.18 |
| IUPAC Name | (1R,2S,6S,8S)-3-benzyl-10,10-dimethyl-8-prop-2-enyl-4,9,11-trioxa-3-azatricyclo[6.3.0.02,6]undecane |
| SMILES | C=CC[C@]12C[C@@H]3CON(Cc4ccccc4)[C@@H]3[C@H]1OC(C)(C)O2 |
| InChI | InChI=1S/C19H25NO3/c1-4-10-19-11-15-13-21-20(12-14-8-6-5-7-9-14)16(15)17(19)22-18(2,3)23-19/h4-9,15-17H,1,10-13H2,2-3H3/t15-,16+,17-,19+/m1/s1 |
| InChIKey | JBBFFMDYJCOODL-NTDBWNAOSA-N |
| XLogP | 3.29 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.41 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|