C17H23NO3 — CID 135011069
(3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoxazinane (PubChem CID 135011069) has the molecular formula C17H23NO3 and a molecular weight of 289.37 g/mol. Its IUPAC name is (3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoxazinane.
| Compound Name | (3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoxazinane |
|---|---|
| PubChem CID | 135011069 |
| Molecular Formula | C17H23NO3 |
| Molecular Weight | 289.37 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | (3R)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-4-methylideneoxazinane |
| SMILES | C=C1CCON(Cc2ccccc2)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C17H23NO3/c1-13-9-10-20-18(11-14-7-5-4-6-8-14)16(13)15-12-19-17(2,3)21-15/h4-8,15-16H,1,9-12H2,2-3H3/t15-,16-/m1/s1 |
| InChIKey | FTIZHSSKZBIODY-HZPDHXFCSA-N |
| XLogP | 2.90 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|