C18H26NO7P — CID 102529006
[(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] dimethyl phosphate (PubChem CID 102529006) has the molecular formula C18H26NO7P and a molecular weight of 399.38 g/mol. Its IUPAC name is [(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] dimethyl phosphate.
| Compound Name | [(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] dimethyl phosphate |
|---|---|
| PubChem CID | 102529006 |
| Molecular Formula | C18H26NO7P |
| Molecular Weight | 399.38 g/mol |
| Exact Mass | 399.14 |
| IUPAC Name | [(3S)-2-benzyl-3-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,6-dihydrooxazin-4-yl] dimethyl phosphate |
| SMILES | COP(=O)(OC)OC1=CCON(Cc2ccccc2)[C@H]1[C@H]1COC(C)(C)O1 |
| InChI | InChI=1S/C18H26NO7P/c1-18(2)23-13-16(25-18)17-15(26-27(20,21-3)22-4)10-11-24-19(17)12-14-8-6-5-7-9-14/h5-10,16-17H,11-13H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | FNYOFTYJDZFUOO-IAGOWNOFSA-N |
| XLogP | 3.26 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.38 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|