C24H23NO3 — CID 66574015
(3E,4R)-1-benzyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-phenylprop-2-ynylidene)azetidin-2-one (PubChem CID 66574015) has the molecular formula C24H23NO3 and a molecular weight of 373.45 g/mol. Its IUPAC name is (3E,4R)-1-benzyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-phenylprop-2-ynylidene)azetidin-2-one.
| Compound Name | (3E,4R)-1-benzyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-phenylprop-2-ynylidene)azetidin-2-one |
|---|---|
| PubChem CID | 66574015 |
| Molecular Formula | C24H23NO3 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.17 |
| IUPAC Name | (3E,4R)-1-benzyl-4-[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]-3-(1-phenylprop-2-ynylidene)azetidin-2-one |
| SMILES | C#C/C(=C1\C(=O)N(Cc2ccccc2)[C@H]1[C@H]1COC(C)(C)O1)c1ccccc1 |
| InChI | InChI=1S/C24H23NO3/c1-4-19(18-13-9-6-10-14-18)21-22(20-16-27-24(2,3)28-20)25(23(21)26)15-17-11-7-5-8-12-17/h1,5-14,20,22H,15-16H2,2-3H3/b21-19+/t20-,22+/m1/s1 |
| InChIKey | KAFMIFYAROSMIY-ACMULUPPSA-N |
| XLogP | 3.64 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|