C23H31NO3S — CID 132527426
(3R)-2-benzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[1,4,2-oxathiazolidine-5,2'-adamantane] (PubChem CID 132527426) has the molecular formula C23H31NO3S and a molecular weight of 401.57 g/mol. Its IUPAC name is (3R)-2-benzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[1,4,2-oxathiazolidine-5,2'-adamantane].
| Compound Name | (3R)-2-benzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[1,4,2-oxathiazolidine-5,2'-adamantane] |
|---|---|
| PubChem CID | 132527426 |
| Molecular Formula | C23H31NO3S |
| Molecular Weight | 401.57 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (3R)-2-benzyl-3-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]spiro[1,4,2-oxathiazolidine-5,2'-adamantane] |
| SMILES | CC1(C)OC[C@H]([C@H]2SC3(ON2Cc2ccccc2)C2CC4CC(C2)CC3C4)O1 |
| InChI | InChI=1S/C23H31NO3S/c1-22(2)25-14-20(26-22)21-24(13-15-6-4-3-5-7-15)27-23(28-21)18-9-16-8-17(11-18)12-19(23)10-16/h3-7,16-21H,8-14H2,1-2H3/t16?,17?,18?,19?,20-,21-,23?/m1/s1 |
| InChIKey | XIPPYTJWJMSHHS-CDGCFOEBSA-N |
| XLogP | 4.80 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.57 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |