C21H26N2O5S — CID 11654635
ethyl 2-[(3R,5S)-2-benzyl-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-oxazolidin-3-yl]-1,3-thiazole-4-carboxylate (PubChem CID 11654635) has the molecular formula C21H26N2O5S and a molecular weight of 418.52 g/mol. Its IUPAC name is ethyl 2-[(3R,5S)-2-benzyl-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-oxazolidin-3-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3R,5S)-2-benzyl-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-oxazolidin-3-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 11654635 |
| Molecular Formula | C21H26N2O5S |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.16 |
| IUPAC Name | ethyl 2-[(3R,5S)-2-benzyl-5-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-1,2-oxazolidin-3-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc([C@H]2C[C@@H]([C@H]3COC(C)(C)O3)ON2Cc2ccccc2)n1 |
| InChI | InChI=1S/C21H26N2O5S/c1-4-25-20(24)15-13-29-19(22-15)16-10-17(18-12-26-21(2,3)27-18)28-23(16)11-14-8-6-5-7-9-14/h5-9,13,16-18H,4,10-12H2,1-3H3/t16-,17+,18-/m1/s1 |
| InChIKey | BDQXRGKBKXVWNC-FGTMMUONSA-N |
| XLogP | 3.72 |
| TPSA | 70.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |