C14H19NO2 — CID 10014213
(3aR,5R,7aR)-1-benzyl-5-methyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole (PubChem CID 10014213) has the molecular formula C14H19NO2 and a molecular weight of 233.31 g/mol. Its IUPAC name is (3aR,5R,7aR)-1-benzyl-5-methyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole.
| Compound Name | (3aR,5R,7aR)-1-benzyl-5-methyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
|---|---|
| PubChem CID | 10014213 |
| Molecular Formula | C14H19NO2 |
| Molecular Weight | 233.31 g/mol |
| Exact Mass | 233.14 |
| IUPAC Name | (3aR,5R,7aR)-1-benzyl-5-methyl-3,3a,4,5,7,7a-hexahydropyrano[3,4-c][1,2]oxazole |
| SMILES | C[C@@H]1C[C@H]2CON(Cc3ccccc3)[C@H]2CO1 |
| InChI | InChI=1S/C14H19NO2/c1-11-7-13-9-17-15(14(13)10-16-11)8-12-5-3-2-4-6-12/h2-6,11,13-14H,7-10H2,1H3/t11-,13+,14+/m1/s1 |
| InChIKey | SPCRXJHHSRTGTH-XBFCOCLRSA-N |
| XLogP | 2.23 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.31 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |