C17H23NO4 — CID 15093917
benzyl 3-[(3aR,6R,7aS)-6-methyl-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazol-1-yl]propanoate (PubChem CID 15093917) has the molecular formula C17H23NO4 and a molecular weight of 305.37 g/mol. Its IUPAC name is benzyl 3-[(3aR,6R,7aS)-6-methyl-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazol-1-yl]propanoate.
| Compound Name | benzyl 3-[(3aR,6R,7aS)-6-methyl-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazol-1-yl]propanoate |
|---|---|
| PubChem CID | 15093917 |
| Molecular Formula | C17H23NO4 |
| Molecular Weight | 305.37 g/mol |
| Exact Mass | 305.16 |
| IUPAC Name | benzyl 3-[(3aR,6R,7aS)-6-methyl-3,3a,4,6,7,7a-hexahydropyrano[4,3-c][1,2]oxazol-1-yl]propanoate |
| SMILES | C[C@@H]1C[C@H]2[C@H](CO1)CON2CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H23NO4/c1-13-9-16-15(11-20-13)12-22-18(16)8-7-17(19)21-10-14-5-3-2-4-6-14/h2-6,13,15-16H,7-12H2,1H3/t13-,15-,16+/m1/s1 |
| InChIKey | QRGOFZUXRGMLKJ-BMFZPTHFSA-N |
| XLogP | 2.16 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.37 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |