About 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate
7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate (PubChem CID 143823138) has the molecular formula C25H30O5
and a molecular weight of 410.51 g/mol. Its IUPAC name is 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate.
Molecular Properties
| Compound Name | 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate |
| PubChem CID | 143823138 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate |
| SMILES | CC1C[C@@H]1c1ccc(COC(=O)CCC(O)CCC(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C25H30O5/c1-18-15-23(18)21-9-7-20(8-10-21)17-30-25(28)14-12-22(26)11-13-24(27)29-16-19-5-3-2-4-6-19/h2-10,18,22-23,26H,11-17H2,1H3/t18?,22?,23-/m0/s1 |
| InChIKey | YRWNSTBMAGJKAS-CKRJSAQMSA-N |
| XLogP | 4.52 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate?
The IUPAC name of 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate (CID 143823138) is 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate.
What is the SMILES notation for 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate?
The canonical SMILES for 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate is CC1C[C@@H]1c1ccc(COC(=O)CCC(O)CCC(=O)OCc2ccccc2)cc1.
What is the InChIKey of 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate?
The InChIKey is YRWNSTBMAGJKAS-CKRJSAQMSA-N. The full InChI is InChI=1S/C25H30O5/c1-18-15-23(18)21-9-7-20(8-10-21)17-30-25(28)14-12-22(26)11-13-24(27)29-16-19-5-3-2-4-6-19/h2-10,18,22-23,26H,11-17H2,1H3/t18?,22?,23-/m0/s1.
What are the key properties of 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate?
7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate has a molecular weight of 410.51 g/mol, XLogP of 4.52, 11 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 7-O-benzyl 1-O-[[4-[(1S)-2-methylcyclopropyl]phenyl]methyl] 4-hydroxyheptanedioate is sourced from PubChem (CID 143823138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).