C22H26N2O5 — CID 14227028
benzyl 3-[(1R,2R,6S,8R,11S,14R)-4-methyl-3,5-dioxo-9-oxa-4,10-diazatetracyclo[6.5.1.02,6.011,14]tetradecan-10-yl]propanoate (PubChem CID 14227028) has the molecular formula C22H26N2O5 and a molecular weight of 398.46 g/mol. Its IUPAC name is benzyl 3-[(1R,2R,6S,8R,11S,14R)-4-methyl-3,5-dioxo-9-oxa-4,10-diazatetracyclo[6.5.1.02,6.011,14]tetradecan-10-yl]propanoate.
| Compound Name | benzyl 3-[(1R,2R,6S,8R,11S,14R)-4-methyl-3,5-dioxo-9-oxa-4,10-diazatetracyclo[6.5.1.02,6.011,14]tetradecan-10-yl]propanoate |
|---|---|
| PubChem CID | 14227028 |
| Molecular Formula | C22H26N2O5 |
| Molecular Weight | 398.46 g/mol |
| Exact Mass | 398.18 |
| IUPAC Name | benzyl 3-[(1R,2R,6S,8R,11S,14R)-4-methyl-3,5-dioxo-9-oxa-4,10-diazatetracyclo[6.5.1.02,6.011,14]tetradecan-10-yl]propanoate |
| SMILES | CN1C(=O)[C@@H]2[C@@H]3CC[C@H]4[C@@H]3[C@@H](C[C@@H]2C1=O)ON4CCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C22H26N2O5/c1-23-21(26)15-11-17-20-14(19(15)22(23)27)7-8-16(20)24(29-17)10-9-18(25)28-12-13-5-3-2-4-6-13/h2-6,14-17,19-20H,7-12H2,1H3/t14-,15-,16-,17+,19+,20+/m0/s1 |
| InChIKey | TXIAIJNJAARJNX-FKAIMOKRSA-N |
| XLogP | 1.77 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|