C22H28O6 — CID 123417748
benzyl 3-(6-acetyloxy-3,5-dimethyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-4-yl)propanoate (PubChem CID 123417748) has the molecular formula C22H28O6 and a molecular weight of 388.46 g/mol. Its IUPAC name is benzyl 3-(6-acetyloxy-3,5-dimethyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-4-yl)propanoate.
| Compound Name | benzyl 3-(6-acetyloxy-3,5-dimethyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-4-yl)propanoate |
|---|---|
| PubChem CID | 123417748 |
| Molecular Formula | C22H28O6 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | benzyl 3-(6-acetyloxy-3,5-dimethyl-1-oxo-3a,4,5,6,7,7a-hexahydro-3H-2-benzofuran-4-yl)propanoate |
| SMILES | CC(=O)OC1CC2C(=O)OC(C)C2C(CCC(=O)OCc2ccccc2)C1C |
| InChI | InChI=1S/C22H28O6/c1-13-17(9-10-20(24)26-12-16-7-5-4-6-8-16)21-14(2)27-22(25)18(21)11-19(13)28-15(3)23/h4-8,13-14,17-19,21H,9-12H2,1-3H3 |
| InChIKey | JLCKLIUPBKESKO-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|