C17H22O6 — CID 59010997
benzyl (3R,4S)-5-acetyloxy-4-methoxy-3-methyloxane-2-carboxylate (PubChem CID 59010997) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is benzyl (3R,4S)-5-acetyloxy-4-methoxy-3-methyloxane-2-carboxylate.
| Compound Name | benzyl (3R,4S)-5-acetyloxy-4-methoxy-3-methyloxane-2-carboxylate |
|---|---|
| PubChem CID | 59010997 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | benzyl (3R,4S)-5-acetyloxy-4-methoxy-3-methyloxane-2-carboxylate |
| SMILES | CO[C@@H]1C(OC(C)=O)COC(C(=O)OCc2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C17H22O6/c1-11-15(20-3)14(23-12(2)18)10-21-16(11)17(19)22-9-13-7-5-4-6-8-13/h4-8,11,14-16H,9-10H2,1-3H3/t11-,14?,15+,16?/m1/s1 |
| InChIKey | KYFJKTVSAHHODL-DIPIGXQDSA-N |
| XLogP | 1.71 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |