C18H20O5 — CID 130351734
benzyl (1aS,2S,3S,3aS,4R,6aS,6bR)-2,4-dimethyl-6-oxo-2,3,3a,4,6a,6b-hexahydro-1aH-oxireno[2,3-e][2]benzofuran-3-carboxylate (PubChem CID 130351734) has the molecular formula C18H20O5 and a molecular weight of 316.35 g/mol. Its IUPAC name is benzyl (1aS,2S,3S,3aS,4R,6aS,6bR)-2,4-dimethyl-6-oxo-2,3,3a,4,6a,6b-hexahydro-1aH-oxireno[2,3-e][2]benzofuran-3-carboxylate.
| Compound Name | benzyl (1aS,2S,3S,3aS,4R,6aS,6bR)-2,4-dimethyl-6-oxo-2,3,3a,4,6a,6b-hexahydro-1aH-oxireno[2,3-e][2]benzofuran-3-carboxylate |
|---|---|
| PubChem CID | 130351734 |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.35 g/mol |
| Exact Mass | 316.13 |
| IUPAC Name | benzyl (1aS,2S,3S,3aS,4R,6aS,6bR)-2,4-dimethyl-6-oxo-2,3,3a,4,6a,6b-hexahydro-1aH-oxireno[2,3-e][2]benzofuran-3-carboxylate |
| SMILES | C[C@@H]1[C@@H]2O[C@@H]2[C@H]2C(=O)O[C@H](C)[C@H]2[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C18H20O5/c1-9-12(17(19)21-8-11-6-4-3-5-7-11)13-10(2)22-18(20)14(13)16-15(9)23-16/h3-7,9-10,12-16H,8H2,1-2H3/t9-,10+,12-,13-,14-,15-,16+/m0/s1 |
| InChIKey | KRIMIRRFKYFBGN-UQBCCFSISA-N |
| XLogP | 1.94 |
| TPSA | 65.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.35 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|