C17H21NO6 — CID 14055711
methyl 2,5-dimethyl-6-oxo-4-(phenylmethoxycarbonylamino)oxane-3-carboxylate (PubChem CID 14055711) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is methyl 2,5-dimethyl-6-oxo-4-(phenylmethoxycarbonylamino)oxane-3-carboxylate.
| Compound Name | methyl 2,5-dimethyl-6-oxo-4-(phenylmethoxycarbonylamino)oxane-3-carboxylate |
|---|---|
| PubChem CID | 14055711 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | methyl 2,5-dimethyl-6-oxo-4-(phenylmethoxycarbonylamino)oxane-3-carboxylate |
| SMILES | COC(=O)C1C(C)OC(=O)C(C)C1NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C17H21NO6/c1-10-14(13(16(20)22-3)11(2)24-15(10)19)18-17(21)23-9-12-7-5-4-6-8-12/h4-8,10-11,13-14H,9H2,1-3H3,(H,18,21) |
| InChIKey | OWIADDNNCWMYER-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|