C29H29N3O8 — CID 162966313
benzyl N-[[(2R,3S,4S)-5-oxo-3,4-bis(phenylmethoxycarbonylamino)oxolan-2-yl]methyl]carbamate (PubChem CID 162966313) has the molecular formula C29H29N3O8 and a molecular weight of 547.56 g/mol. Its IUPAC name is benzyl N-[[(2R,3S,4S)-5-oxo-3,4-bis(phenylmethoxycarbonylamino)oxolan-2-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(2R,3S,4S)-5-oxo-3,4-bis(phenylmethoxycarbonylamino)oxolan-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 162966313 |
| Molecular Formula | C29H29N3O8 |
| Molecular Weight | 547.56 g/mol |
| Exact Mass | 547.20 |
| IUPAC Name | benzyl N-[[(2R,3S,4S)-5-oxo-3,4-bis(phenylmethoxycarbonylamino)oxolan-2-yl]methyl]carbamate |
| SMILES | O=C(NC[C@H]1OC(=O)[C@@H](NC(=O)OCc2ccccc2)[C@@H]1NC(=O)OCc1ccccc1)OCc1ccccc1 |
| InChI | InChI=1S/C29H29N3O8/c33-26-25(32-29(36)39-19-22-14-8-3-9-15-22)24(31-28(35)38-18-21-12-6-2-7-13-21)23(40-26)16-30-27(34)37-17-20-10-4-1-5-11-20/h1-15,23-25H,16-19H2,(H,30,34)(H,31,35)(H,32,36)/t23-,24-,25+/m1/s1 |
| InChIKey | BGDUILZGDVWCSC-SDHSZQHLSA-N |
| XLogP | 3.43 |
| TPSA | 141.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.56 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|