C26H32N2O8 — CID 167639361
benzyl N-(5-hydroxyoxan-3-yl)carbamate;benzyl N-(5-oxooxan-3-yl)carbamate (PubChem CID 167639361) has the molecular formula C26H32N2O8 and a molecular weight of 500.55 g/mol. Its IUPAC name is benzyl N-(5-hydroxyoxan-3-yl)carbamate;benzyl N-(5-oxooxan-3-yl)carbamate.
| Compound Name | benzyl N-(5-hydroxyoxan-3-yl)carbamate;benzyl N-(5-oxooxan-3-yl)carbamate |
|---|---|
| PubChem CID | 167639361 |
| Molecular Formula | C26H32N2O8 |
| Molecular Weight | 500.55 g/mol |
| Exact Mass | 500.22 |
| IUPAC Name | benzyl N-(5-hydroxyoxan-3-yl)carbamate;benzyl N-(5-oxooxan-3-yl)carbamate |
| SMILES | O=C(NC1COCC(O)C1)OCc1ccccc1.O=C1COCC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C13H17NO4.C13H15NO4/c2*15-12-6-11(8-17-9-12)14-13(16)18-7-10-4-2-1-3-5-10/h1-5,11-12,15H,6-9H2,(H,14,16);1-5,11H,6-9H2,(H,14,16) |
| InChIKey | OYCVIKWSGFTDLJ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |