C19H27NO6 — CID 158931508
benzyl N-(3-oxocyclobutyl)carbamate;methane;3-oxocyclobutane-1-carboxylic acid (PubChem CID 158931508) has the molecular formula C19H27NO6 and a molecular weight of 365.43 g/mol. Its IUPAC name is benzyl N-(3-oxocyclobutyl)carbamate;methane;3-oxocyclobutane-1-carboxylic acid.
| Compound Name | benzyl N-(3-oxocyclobutyl)carbamate;methane;3-oxocyclobutane-1-carboxylic acid |
|---|---|
| PubChem CID | 158931508 |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | benzyl N-(3-oxocyclobutyl)carbamate;methane;3-oxocyclobutane-1-carboxylic acid |
| SMILES | C.C.O=C1CC(C(=O)O)C1.O=C1CC(NC(=O)OCc2ccccc2)C1 |
| InChI | InChI=1S/C12H13NO3.C5H6O3.2CH4/c14-11-6-10(7-11)13-12(15)16-8-9-4-2-1-3-5-9;6-4-1-3(2-4)5(7)8;;/h1-5,10H,6-8H2,(H,13,15);3H,1-2H2,(H,7,8);2*1H4 |
| InChIKey | JJCSKLYHQJJZOZ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |