C14H19NO6 — CID 134846363
benzyl N-[(3R,4R,5R,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]carbamate (PubChem CID 134846363) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is benzyl N-[(3R,4R,5R,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]carbamate.
| Compound Name | benzyl N-[(3R,4R,5R,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]carbamate |
|---|---|
| PubChem CID | 134846363 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | benzyl N-[(3R,4R,5R,6S)-2,3,5-trihydroxy-6-methyloxan-4-yl]carbamate |
| SMILES | C[C@@H]1OC(O)[C@H](O)[C@H](NC(=O)OCc2ccccc2)[C@H]1O |
| InChI | InChI=1S/C14H19NO6/c1-8-11(16)10(12(17)13(18)21-8)15-14(19)20-7-9-5-3-2-4-6-9/h2-6,8,10-13,16-18H,7H2,1H3,(H,15,19)/t8-,10+,11-,12+,13?/m0/s1 |
| InChIKey | SLSGIDMKVJOLLR-QWMIXWFQSA-N |
| XLogP | -0.26 |
| TPSA | 108.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |