C21H24N2O7 — CID 18660929
benzyl N-[(2S,3R,4R,5S,6S)-6-carbamoyl-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]carbamate (PubChem CID 18660929) has the molecular formula C21H24N2O7 and a molecular weight of 416.43 g/mol. Its IUPAC name is benzyl N-[(2S,3R,4R,5S,6S)-6-carbamoyl-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]carbamate.
| Compound Name | benzyl N-[(2S,3R,4R,5S,6S)-6-carbamoyl-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]carbamate |
|---|---|
| PubChem CID | 18660929 |
| Molecular Formula | C21H24N2O7 |
| Molecular Weight | 416.43 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | benzyl N-[(2S,3R,4R,5S,6S)-6-carbamoyl-4,5-dihydroxy-2-phenylmethoxyoxan-3-yl]carbamate |
| SMILES | NC(=O)[C@H]1O[C@H](OCc2ccccc2)[C@H](NC(=O)OCc2ccccc2)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C21H24N2O7/c22-19(26)18-17(25)16(24)15(20(30-18)28-11-13-7-3-1-4-8-13)23-21(27)29-12-14-9-5-2-6-10-14/h1-10,15-18,20,24-25H,11-12H2,(H2,22,26)(H,23,27)/t15-,16-,17+,18+,20+/m1/s1 |
| InChIKey | UNATXXSWYBQMFX-JGLNRKDHSA-N |
| XLogP | 0.43 |
| TPSA | 140.34 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.43 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |