C31H41N3O10 — CID 101163788
ethyl 2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]acetate (PubChem CID 101163788) has the molecular formula C31H41N3O10 and a molecular weight of 615.68 g/mol. Its IUPAC name is ethyl 2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]acetate.
| Compound Name | ethyl 2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 101163788 |
| Molecular Formula | C31H41N3O10 |
| Molecular Weight | 615.68 g/mol |
| Exact Mass | 615.28 |
| IUPAC Name | ethyl 2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]acetate |
| SMILES | CCOC(=O)CNC(=O)[C@H]1O[C@H](OCc2ccccc2)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OCc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C31H41N3O10/c1-4-41-23(35)16-32-29(39)27-26(37)25(36)24(30(44-27)42-17-20-11-7-5-8-12-20)34-28(38)22(15-19(2)3)33-31(40)43-18-21-13-9-6-10-14-21/h5-14,19,22,24-27,30,36-37H,4,15-18H2,1-3H3,(H,32,39)(H,33,40)(H,34,38)/t22-,24+,25+,26+,27-,30-/m0/s1 |
| InChIKey | HDTNZDIXCBXWFW-JGQQEVGCSA-N |
| XLogP | 1.16 |
| TPSA | 181.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.68 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |