C25H30N2O9 — CID 11060193
methyl 3-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxane-2-carbonyl]amino]propanoate (PubChem CID 11060193) has the molecular formula C25H30N2O9 and a molecular weight of 502.52 g/mol. Its IUPAC name is methyl 3-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxane-2-carbonyl]amino]propanoate.
| Compound Name | methyl 3-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxane-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 11060193 |
| Molecular Formula | C25H30N2O9 |
| Molecular Weight | 502.52 g/mol |
| Exact Mass | 502.20 |
| IUPAC Name | methyl 3-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-6-phenylmethoxy-5-(phenylmethoxycarbonylamino)oxane-2-carbonyl]amino]propanoate |
| SMILES | COC(=O)CCNC(=O)[C@H]1O[C@H](OCc2ccccc2)[C@H](NC(=O)OCc2ccccc2)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C25H30N2O9/c1-33-18(28)12-13-26-23(31)22-21(30)20(29)19(24(36-22)34-14-16-8-4-2-5-9-16)27-25(32)35-15-17-10-6-3-7-11-17/h2-11,19-22,24,29-30H,12-15H2,1H3,(H,26,31)(H,27,32)/t19-,20-,21-,22+,24+/m1/s1 |
| InChIKey | YATNSKRVJHQWJN-HGUQERDASA-N |
| XLogP | 0.62 |
| TPSA | 152.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.52 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |