C36H43N3O10 — CID 101163791
methyl (2S)-2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]-2-phenylacetate (PubChem CID 101163791) has the molecular formula C36H43N3O10 and a molecular weight of 677.75 g/mol. Its IUPAC name is methyl (2S)-2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]-2-phenylacetate.
| Compound Name | methyl (2S)-2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]-2-phenylacetate |
|---|---|
| PubChem CID | 101163791 |
| Molecular Formula | C36H43N3O10 |
| Molecular Weight | 677.75 g/mol |
| Exact Mass | 677.29 |
| IUPAC Name | methyl (2S)-2-[[(2S,3R,4R,5R,6S)-3,4-dihydroxy-5-[[(2S)-4-methyl-2-(phenylmethoxycarbonylamino)pentanoyl]amino]-6-phenylmethoxyoxane-2-carbonyl]amino]-2-phenylacetate |
| SMILES | COC(=O)[C@@H](NC(=O)[C@H]1O[C@H](OCc2ccccc2)[C@H](NC(=O)[C@H](CC(C)C)NC(=O)OCc2ccccc2)[C@@H](O)[C@H]1O)c1ccccc1 |
| InChI | InChI=1S/C36H43N3O10/c1-22(2)19-26(37-36(45)48-21-24-15-9-5-10-16-24)32(42)39-28-29(40)30(41)31(49-35(28)47-20-23-13-7-4-8-14-23)33(43)38-27(34(44)46-3)25-17-11-6-12-18-25/h4-18,22,26-31,35,40-41H,19-21H2,1-3H3,(H,37,45)(H,38,43)(H,39,42)/t26-,27-,28+,29+,30+,31-,35-/m0/s1 |
| InChIKey | IBCMEPPSFZOYGO-KJOLEMFESA-N |
| XLogP | 2.51 |
| TPSA | 181.75 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 677.75 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |