C29H31NO6 — CID 11752172
benzyl N-[(1S,3R,4S,5S,6R,7R)-3-methoxy-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptan-5-yl]carbamate (PubChem CID 11752172) has the molecular formula C29H31NO6 and a molecular weight of 489.57 g/mol. Its IUPAC name is benzyl N-[(1S,3R,4S,5S,6R,7R)-3-methoxy-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptan-5-yl]carbamate.
| Compound Name | benzyl N-[(1S,3R,4S,5S,6R,7R)-3-methoxy-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptan-5-yl]carbamate |
|---|---|
| PubChem CID | 11752172 |
| Molecular Formula | C29H31NO6 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | benzyl N-[(1S,3R,4S,5S,6R,7R)-3-methoxy-6,7-bis(phenylmethoxy)-2-oxabicyclo[2.2.1]heptan-5-yl]carbamate |
| SMILES | CO[C@@H]1O[C@@H]2[C@H](OCc3ccccc3)[C@@H](NC(=O)OCc3ccccc3)[C@H]1[C@H]2OCc1ccccc1 |
| InChI | InChI=1S/C29H31NO6/c1-32-28-23-24(30-29(31)35-19-22-15-9-4-10-16-22)26(34-18-21-13-7-3-8-14-21)27(36-28)25(23)33-17-20-11-5-2-6-12-20/h2-16,23-28H,17-19H2,1H3,(H,30,31)/t23-,24-,25+,26+,27-,28+/m0/s1 |
| InChIKey | GQTLPLJDUVNNFV-WBKISLEQSA-N |
| XLogP | 4.45 |
| TPSA | 75.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |