C20H22O4S — CID 23630806
benzyl (1R,3aS,8aS,9S,9aR)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carboxylate (PubChem CID 23630806) has the molecular formula C20H22O4S and a molecular weight of 358.46 g/mol. Its IUPAC name is benzyl (1R,3aS,8aS,9S,9aR)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carboxylate.
| Compound Name | benzyl (1R,3aS,8aS,9S,9aR)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carboxylate |
|---|---|
| PubChem CID | 23630806 |
| Molecular Formula | C20H22O4S |
| Molecular Weight | 358.46 g/mol |
| Exact Mass | 358.12 |
| IUPAC Name | benzyl (1R,3aS,8aS,9S,9aR)-1-methyl-3-oxo-1,3a,5,7,8,8a,9,9a-octahydrothiopyrano[4,3-f][2]benzofuran-9-carboxylate |
| SMILES | C[C@H]1OC(=O)[C@H]2C=C3CSCC[C@H]3[C@H](C(=O)OCc3ccccc3)[C@@H]21 |
| InChI | InChI=1S/C20H22O4S/c1-12-17-16(19(21)24-12)9-14-11-25-8-7-15(14)18(17)20(22)23-10-13-5-3-2-4-6-13/h2-6,9,12,15-18H,7-8,10-11H2,1H3/t12-,15-,16+,17-,18+/m1/s1 |
| InChIKey | JRDZZFKGDBBXNT-CUWKQTPXSA-N |
| XLogP | 3.22 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|