C26H27NO3 — CID 66696473
(1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-diphenyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide (PubChem CID 66696473) has the molecular formula C26H27NO3 and a molecular weight of 401.51 g/mol. Its IUPAC name is (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-diphenyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide.
| Compound Name | (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-diphenyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide |
|---|---|
| PubChem CID | 66696473 |
| Molecular Formula | C26H27NO3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.20 |
| IUPAC Name | (1R,3aR,8aS,9S,9aS)-1-methyl-3-oxo-N,N-diphenyl-3a,5,6,7,8,8a,9,9a-octahydro-1H-benzo[f][2]benzofuran-9-carboxamide |
| SMILES | C[C@H]1OC(=O)[C@@H]2C=C3CCCC[C@H]3[C@H](C(=O)N(c3ccccc3)c3ccccc3)[C@H]12 |
| InChI | InChI=1S/C26H27NO3/c1-17-23-22(26(29)30-17)16-18-10-8-9-15-21(18)24(23)25(28)27(19-11-4-2-5-12-19)20-13-6-3-7-14-20/h2-7,11-14,16-17,21-24H,8-10,15H2,1H3/t17-,21-,22-,23-,24+/m1/s1 |
| InChIKey | ZZXVWUQUULWKHY-PNBSKESLSA-N |
| XLogP | 5.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|