C16H21NO3 — CID 175220855
benzyl 3-acetyl-4,5-dimethylpyrrolidine-2-carboxylate (PubChem CID 175220855) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is benzyl 3-acetyl-4,5-dimethylpyrrolidine-2-carboxylate.
| Compound Name | benzyl 3-acetyl-4,5-dimethylpyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 175220855 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | benzyl 3-acetyl-4,5-dimethylpyrrolidine-2-carboxylate |
| SMILES | CC(=O)C1C(C(=O)OCc2ccccc2)NC(C)C1C |
| InChI | InChI=1S/C16H21NO3/c1-10-11(2)17-15(14(10)12(3)18)16(19)20-9-13-7-5-4-6-8-13/h4-8,10-11,14-15,17H,9H2,1-3H3 |
| InChIKey | XLMFBNVCTSJTJT-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |